/* * Copyright (c) 2018-2021, Andreas Kling * Copyright (c) 2021, Linus Groh * All rights reserved. * * Redistribution and use in source and binary forms, with or without * modification, are permitted provided that the following conditions are met: * * 1. Redistributions of source code must retain the above copyright notice, this * list of conditions and the following disclaimer. * * 2. Redistributions in binary form must reproduce the above copyright notice, * this list of conditions and the following disclaimer in the documentation * and/or other materials provided with the distribution. * * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE * DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR * SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER * CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, * OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE * OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. */ #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include namespace Web::DOM { Document::Document(const URL& url) : ParentNode(*this, NodeType::DOCUMENT_NODE) , m_style_resolver(make(*this)) , m_style_sheets(CSS::StyleSheetList::create(*this)) , m_url(url) , m_window(Window::create_with_document(*this)) , m_implementation(DOMImplementation::create(*this)) { m_style_update_timer = Core::Timer::create_single_shot(0, [this] { update_style(); }); m_forced_layout_timer = Core::Timer::create_single_shot(0, [this] { force_layout(); }); } Document::~Document() { } void Document::removed_last_ref() { VERIFY(!ref_count()); VERIFY(!m_deletion_has_begun); if (m_referencing_node_count) { // The document has reached ref_count==0 but still has nodes keeping it alive. // At this point, sever all the node links we control. // If nodes remain elsewhere (e.g JS wrappers), they will keep the document alive. // NOTE: This makes sure we stay alive across for the duration of the cleanup below. increment_referencing_node_count(); m_focused_element = nullptr; m_hovered_node = nullptr; m_pending_parsing_blocking_script = nullptr; m_inspected_node = nullptr; m_scripts_to_execute_when_parsing_has_finished.clear(); m_scripts_to_execute_as_soon_as_possible.clear(); m_associated_inert_template_document = nullptr; m_interpreter = nullptr; { // Gather up all the descendants of this document and prune them from the tree. // FIXME: This could definitely be more elegant. NonnullRefPtrVector descendants; for_each_in_inclusive_subtree([&](auto& node) { if (&node != this) descendants.append(node); return IterationDecision::Continue; }); for (auto& node : descendants) { VERIFY(&node.document() == this); VERIFY(!node.is_document()); if (node.parent()) node.remove(); } } m_in_removed_last_ref = false; decrement_referencing_node_count(); return; } m_in_removed_last_ref = false; m_deletion_has_begun = true; delete this; } Origin Document::origin() const { if (!m_url.is_valid()) return {}; return { m_url.protocol(), m_url.host(), m_url.port() }; } void Document::set_origin(const Origin& origin) { m_url.set_protocol(origin.protocol()); m_url.set_host(origin.host()); m_url.set_port(origin.port()); } void Document::schedule_style_update() { if (m_style_update_timer->is_active()) return; m_style_update_timer->start(); } void Document::schedule_forced_layout() { if (m_forced_layout_timer->is_active()) return; m_forced_layout_timer->start(); } bool Document::is_child_allowed(const Node& node) const { switch (node.type()) { case NodeType::DOCUMENT_NODE: case NodeType::TEXT_NODE: return false; case NodeType::COMMENT_NODE: return true; case NodeType::DOCUMENT_TYPE_NODE: return !first_child_of_type(); case NodeType::ELEMENT_NODE: return !first_child_of_type(); default: return false; } } Element* Document::document_element() { return first_child_of_type(); } const Element* Document::document_element() const { return first_child_of_type(); } const HTML::HTMLHtmlElement* Document::html_element() const { auto* html = document_element(); if (is(html)) return downcast(html); return nullptr; } const HTML::HTMLHeadElement* Document::head() const { auto* html = html_element(); if (!html) return nullptr; return html->first_child_of_type(); } const HTML::HTMLElement* Document::body() const { auto* html = html_element(); if (!html) return nullptr; auto* first_body = html->first_child_of_type(); if (first_body) return first_body; auto* first_frameset = html->first_child_of_type(); if (first_frameset) return first_frameset; return nullptr; } // https://html.spec.whatwg.org/multipage/dom.html#dom-document-body ExceptionOr Document::set_body(HTML::HTMLElement& new_body) { if (!is(new_body) && !is(new_body)) return DOM::HierarchyRequestError::create("Invalid document body element, must be 'body' or 'frameset'"); auto* existing_body = body(); if (existing_body) { TODO(); return {}; } auto* document_element = this->document_element(); if (!document_element) return DOM::HierarchyRequestError::create("Missing document element"); document_element->append_child(new_body); return {}; } String Document::title() const { auto* head_element = head(); if (!head_element) return {}; auto* title_element = head_element->first_child_of_type(); if (!title_element) return {}; auto raw_title = title_element->text_content(); StringBuilder builder; bool last_was_space = false; for (auto code_point : Utf8View(raw_title)) { if (isspace(code_point)) { last_was_space = true; } else { if (last_was_space && !builder.is_empty()) builder.append(' '); builder.append_code_point(code_point); last_was_space = false; } } return builder.to_string(); } void Document::set_title(const String& title) { auto* head_element = const_cast(head()); if (!head_element) return; RefPtr title_element = head_element->first_child_of_type(); if (!title_element) { title_element = static_ptr_cast(create_element(HTML::TagNames::title)); head_element->append_child(*title_element); } title_element->remove_all_children(true); title_element->append_child(adopt(*new Text(*this, title))); if (auto* page = this->page()) { if (frame() == &page->main_frame()) page->client().page_did_change_title(title); } } void Document::attach_to_frame(Badge, Frame& frame) { m_frame = frame; update_layout(); } void Document::detach_from_frame(Badge, Frame& frame) { VERIFY(&frame == m_frame); tear_down_layout_tree(); m_frame = nullptr; } void Document::tear_down_layout_tree() { if (!m_layout_root) return; // Gather up all the layout nodes in a vector and detach them from parents // while the vector keeps them alive. NonnullRefPtrVector layout_nodes; m_layout_root->for_each_in_inclusive_subtree([&](auto& layout_node) { layout_nodes.append(layout_node); return IterationDecision::Continue; }); for (auto& layout_node : layout_nodes) { if (layout_node.parent()) layout_node.parent()->remove_child(layout_node); } m_layout_root = nullptr; } Color Document::background_color(const Palette& palette) const { auto default_color = palette.base(); auto* body_element = body(); if (!body_element) return default_color; auto* body_layout_node = body_element->layout_node(); if (!body_layout_node) return default_color; auto color = body_layout_node->computed_values().background_color(); if (!color.alpha()) return default_color; return color; } RefPtr Document::background_image() const { auto* body_element = body(); if (!body_element) return {}; auto* body_layout_node = body_element->layout_node(); if (!body_layout_node) return {}; auto background_image = body_layout_node->background_image(); if (!background_image) return {}; return background_image->bitmap(); } CSS::Repeat Document::background_repeat_x() const { auto* body_element = body(); if (!body_element) return CSS::Repeat::Repeat; auto* body_layout_node = body_element->layout_node(); if (!body_layout_node) return CSS::Repeat::Repeat; return body_layout_node->computed_values().background_repeat_x(); } CSS::Repeat Document::background_repeat_y() const { auto* body_element = body(); if (!body_element) return CSS::Repeat::Repeat; auto* body_layout_node = body_element->layout_node(); if (!body_layout_node) return CSS::Repeat::Repeat; return body_layout_node->computed_values().background_repeat_y(); } URL Document::complete_url(const String& string) const { return m_url.complete_url(string); } void Document::invalidate_layout() { tear_down_layout_tree(); } void Document::force_layout() { invalidate_layout(); update_layout(); } void Document::update_layout() { if (!frame()) return; if (!m_layout_root) { Layout::TreeBuilder tree_builder; m_layout_root = static_ptr_cast(tree_builder.build(*this)); } Layout::BlockFormattingContext root_formatting_context(*m_layout_root, nullptr); root_formatting_context.run(*m_layout_root, Layout::LayoutMode::Default); m_layout_root->set_needs_display(); if (frame()->is_main_frame()) { if (auto* page = this->page()) page->client().page_did_layout(); } } static void update_style_recursively(DOM::Node& node) { node.for_each_child([&](auto& child) { if (child.needs_style_update()) { if (is(child)) downcast(child).recompute_style(); child.set_needs_style_update(false); } if (child.child_needs_style_update()) { update_style_recursively(child); child.set_child_needs_style_update(false); } return IterationDecision::Continue; }); } void Document::update_style() { update_style_recursively(*this); update_layout(); } RefPtr Document::create_layout_node() { return adopt(*new Layout::InitialContainingBlockBox(*this, CSS::StyleProperties::create())); } void Document::set_link_color(Color color) { m_link_color = color; } void Document::set_active_link_color(Color color) { m_active_link_color = color; } void Document::set_visited_link_color(Color color) { m_visited_link_color = color; } const Layout::InitialContainingBlockBox* Document::layout_node() const { return static_cast(Node::layout_node()); } Layout::InitialContainingBlockBox* Document::layout_node() { return static_cast(Node::layout_node()); } void Document::set_inspected_node(Node* node) { if (m_inspected_node == node) return; if (m_inspected_node && m_inspected_node->layout_node()) m_inspected_node->layout_node()->set_needs_display(); m_inspected_node = node; if (m_inspected_node && m_inspected_node->layout_node()) m_inspected_node->layout_node()->set_needs_display(); } void Document::set_hovered_node(Node* node) { if (m_hovered_node == node) return; RefPtr old_hovered_node = move(m_hovered_node); m_hovered_node = node; invalidate_style(); } NonnullRefPtrVector Document::get_elements_by_name(const String& name) const { NonnullRefPtrVector elements; for_each_in_inclusive_subtree_of_type([&](auto& element) { if (element.attribute(HTML::AttributeNames::name) == name) elements.append(element); return IterationDecision::Continue; }); return elements; } NonnullRefPtrVector Document::get_elements_by_tag_name(const FlyString& tag_name) const { // FIXME: Support "*" for tag_name // https://dom.spec.whatwg.org/#concept-getelementsbytagname NonnullRefPtrVector elements; for_each_in_inclusive_subtree_of_type([&](auto& element) { if (element.namespace_() == Namespace::HTML ? element.local_name().to_lowercase() == tag_name.to_lowercase() : element.local_name() == tag_name) { elements.append(element); } return IterationDecision::Continue; }); return elements; } NonnullRefPtrVector Document::get_elements_by_class_name(const FlyString& class_name) const { NonnullRefPtrVector elements; for_each_in_inclusive_subtree_of_type([&](auto& element) { if (element.has_class(class_name, in_quirks_mode() ? CaseSensitivity::CaseInsensitive : CaseSensitivity::CaseSensitive)) elements.append(element); return IterationDecision::Continue; }); return elements; } Color Document::link_color() const { if (m_link_color.has_value()) return m_link_color.value(); if (!page()) return Color::Blue; return page()->palette().link(); } Color Document::active_link_color() const { if (m_active_link_color.has_value()) return m_active_link_color.value(); if (!page()) return Color::Red; return page()->palette().active_link(); } Color Document::visited_link_color() const { if (m_visited_link_color.has_value()) return m_visited_link_color.value(); if (!page()) return Color::Magenta; return page()->palette().visited_link(); } JS::Interpreter& Document::interpreter() { if (!m_interpreter) { auto& vm = Bindings::main_thread_vm(); // TODO: Hook up vm.on_promise_unhandled_rejection and vm.on_promise_rejection_handled // See https://developer.mozilla.org/en-US/docs/Web/JavaScript/Guide/Using_promises#promise_rejection_events m_interpreter = JS::Interpreter::create(vm, *m_window); } return *m_interpreter; } JS::Value Document::run_javascript(const StringView& source, const StringView& filename) { auto parser = JS::Parser(JS::Lexer(source, filename)); auto program = parser.parse_program(); if (parser.has_errors()) { parser.print_errors(); return JS::js_undefined(); } auto& interpreter = document().interpreter(); auto& vm = interpreter.vm(); interpreter.run(interpreter.global_object(), *program); if (vm.exception()) vm.clear_exception(); return vm.last_value(); } // https://dom.spec.whatwg.org/#dom-document-createelement // FIXME: This only implements step 6 of the algorithm and does not take in options. NonnullRefPtr Document::create_element(const String& tag_name) { // FIXME: Let namespace be the HTML namespace, if this is an HTML document or this’s content type is "application/xhtml+xml", and null otherwise. return DOM::create_element(*this, tag_name, Namespace::HTML); } // https://dom.spec.whatwg.org/#internal-createelementns-steps // FIXME: This only implements step 4 of the algorithm and does not take in options. NonnullRefPtr Document::create_element_ns(const String& namespace_, const String& qualified_name) { return DOM::create_element(*this, qualified_name, namespace_); } NonnullRefPtr Document::create_document_fragment() { return adopt(*new DocumentFragment(*this)); } NonnullRefPtr Document::create_text_node(const String& data) { return adopt(*new Text(*this, data)); } NonnullRefPtr Document::create_comment(const String& data) { return adopt(*new Comment(*this, data)); } NonnullRefPtr Document::create_range() { return Range::create(*this); } // https://dom.spec.whatwg.org/#dom-document-createevent NonnullRefPtr Document::create_event(const String& interface) { auto interface_lowercase = interface.to_lowercase(); RefPtr event; if (interface_lowercase == "beforeunloadevent") { event = Event::create(""); // FIXME: Create BeforeUnloadEvent } else if (interface_lowercase == "compositionevent") { event = Event::create(""); // FIXME: Create CompositionEvent } else if (interface_lowercase == "customevent") { event = Event::create(""); // FIXME: Create CustomEvent } else if (interface_lowercase == "devicemotionevent") { event = Event::create(""); // FIXME: Create DeviceMotionEvent } else if (interface_lowercase == "deviceorientationevent") { event = Event::create(""); // FIXME: Create DeviceOrientationEvent } else if (interface_lowercase == "dragevent") { event = Event::create(""); // FIXME: Create DragEvent } else if (interface_lowercase.is_one_of("event", "events")) { event = Event::create(""); } else if (interface_lowercase == "focusevent") { event = Event::create(""); // FIXME: Create FocusEvent } else if (interface_lowercase == "hashchangeevent") { event = Event::create(""); // FIXME: Create HashChangeEvent } else if (interface_lowercase == "htmlevents") { event = Event::create(""); } else if (interface_lowercase == "keyboardevent") { event = Event::create(""); // FIXME: Create KeyboardEvent } else if (interface_lowercase == "messageevent") { event = Event::create(""); // FIXME: Create MessageEvent } else if (interface_lowercase.is_one_of("mouseevent", "mouseevents")) { event = UIEvents::MouseEvent::create("", 0, 0); } else if (interface_lowercase == "storageevent") { event = Event::create(""); // FIXME: Create StorageEvent } else if (interface_lowercase == "svgevents") { event = Event::create(""); } else if (interface_lowercase == "textevent") { event = Event::create(""); // FIXME: Create CompositionEvent } else if (interface_lowercase == "touchevent") { event = Event::create(""); // FIXME: Create TouchEvent } else if (interface_lowercase.is_one_of("uievent", "uievents")) { event = UIEvents::UIEvent::create(""); } else { // FIXME: // 3. If constructor is null, then throw a "NotSupportedError" DOMException. // 4. If the interface indicated by constructor is not exposed on the relevant global object of this, then throw a "NotSupportedError" DOMException. TODO(); } // Setting type to empty string is handled by each constructor. // FIXME: // 7. Initialize event’s timeStamp attribute to a DOMHighResTimeStamp representing the high resolution time from the time origin to now. event->set_is_trusted(false); event->set_initialized(false); return event.release_nonnull(); } void Document::set_pending_parsing_blocking_script(Badge, HTML::HTMLScriptElement* script) { m_pending_parsing_blocking_script = script; } NonnullRefPtr Document::take_pending_parsing_blocking_script(Badge) { return m_pending_parsing_blocking_script.release_nonnull(); } void Document::add_script_to_execute_when_parsing_has_finished(Badge, HTML::HTMLScriptElement& script) { m_scripts_to_execute_when_parsing_has_finished.append(script); } NonnullRefPtrVector Document::take_scripts_to_execute_when_parsing_has_finished(Badge) { return move(m_scripts_to_execute_when_parsing_has_finished); } void Document::add_script_to_execute_as_soon_as_possible(Badge, HTML::HTMLScriptElement& script) { m_scripts_to_execute_as_soon_as_possible.append(script); } NonnullRefPtrVector Document::take_scripts_to_execute_as_soon_as_possible(Badge) { return move(m_scripts_to_execute_as_soon_as_possible); } // https://dom.spec.whatwg.org/#concept-node-adopt void Document::adopt_node(Node& node) { auto& old_document = node.document(); if (node.parent()) node.remove(); if (&old_document != this) { // FIXME: This should be shadow-including. node.for_each_in_inclusive_subtree([&](auto& inclusive_descendant) { inclusive_descendant.set_document({}, *this); // FIXME: If inclusiveDescendant is an element, then set the node document of each attribute in inclusiveDescendant’s attribute list to document. return IterationDecision::Continue; }); // FIXME: For each inclusiveDescendant in node’s shadow-including inclusive descendants that is custom, // enqueue a custom element callback reaction with inclusiveDescendant, callback name "adoptedCallback", // and an argument list containing oldDocument and document. // FIXME: This should be shadow-including. node.for_each_in_inclusive_subtree([&](auto& inclusive_descendant) { inclusive_descendant.adopted_from(old_document); return IterationDecision::Continue; }); } } // https://dom.spec.whatwg.org/#dom-document-adoptnode NonnullRefPtr Document::adopt_node_binding(NonnullRefPtr node) { if (is(*node)) { dbgln("Document::adopt_node_binding: Cannot adopt a document into a document (FIXME: throw as NotSupportedError exception, see issue #6075"); return node; } if (is(*node)) { dbgln("Document::adopt_node_binding: Cannot adopt a shadow root into a document (FIXME: throw as HierarchyRequestError exception, see issue #6075"); return node; } if (is(*node) && downcast(*node).host()) return node; adopt_node(*node); return node; } const DocumentType* Document::doctype() const { return first_child_of_type(); } const String& Document::compat_mode() const { static String back_compat = "BackCompat"; static String css1_compat = "CSS1Compat"; if (m_quirks_mode == QuirksMode::Yes) return back_compat; return css1_compat; } bool Document::is_editable() const { return m_editable; } void Document::set_focused_element(Element* element) { if (m_focused_element == element) return; m_focused_element = element; if (m_layout_root) m_layout_root->set_needs_display(); } void Document::set_ready_state(const String& ready_state) { m_ready_state = ready_state; dispatch_event(Event::create(HTML::EventNames::readystatechange)); } Page* Document::page() { return m_frame ? m_frame->page() : nullptr; } const Page* Document::page() const { return m_frame ? m_frame->page() : nullptr; } EventTarget* Document::get_parent(const Event& event) { if (event.type() == HTML::EventNames::load) return nullptr; return &window(); } void Document::completely_finish_loading() { // FIXME: This needs to handle iframes. dispatch_event(DOM::Event::create(HTML::EventNames::load)); } String Document::cookie() const { // FIXME: Support cookies! return {}; } void Document::set_cookie(String) { // FIXME: Support cookies! } }