1
Fork 0
mirror of https://github.com/RGBCube/serenity synced 2026-01-13 12:11:01 +00:00
serenity/Userland/Libraries/LibWeb/DOM/Document.cpp
Luke Wilde 631bbcd00a LibJS: Refactor interpreter to use Script and Source Text Modules
This also refactors interpreter creation to follow
InitializeHostDefinedRealm, but I couldn't fit it in the title :^)

This allows us to follow the spec much more closely rather than being
completely ad-hoc with just the parse node instead of having all the
surrounding data such as the realm of the parse node.

The interpreter creation refactor creates the global execution context
once and doesn't take it off the stack. This allows LibWeb to take the
global execution context and manually handle it, following the HTML
spec. The HTML spec calls this the "realm execution context" of the
environment settings object.

It also allows us to specify the globalThis type, as it can be
different from the global object type. For example, on the web, Window
global objects use a WindowProxy global this value to enforce the same
origin policy on operations like [[GetOwnProperty]].

Finally, it allows us to directly call Program::execute in perform_eval
and perform_shadow_realm_eval as this moves
global_declaration_instantiation into Interpreter::run
(ScriptEvaluation) as per the spec.

Note that this doesn't evalulate Source Text Modules yet or refactor
the bytecode interpreter, that's work for future us :^)

This patch was originally build by Luke for the environment settings
object change but was also needed for modules. So I (davidot) have
modified it with the new completion changes and setup for that.

Co-authored-by: davidot <davidot@serenityos.org>
2022-01-22 01:21:18 +00:00

1150 lines
39 KiB
C++
Raw Blame History

This file contains ambiguous Unicode characters

This file contains Unicode characters that might be confused with other characters. If you think that this is intentional, you can safely ignore this warning. Use the Escape button to reveal them.

/*
* Copyright (c) 2018-2021, Andreas Kling <kling@serenityos.org>
* Copyright (c) 2021, Linus Groh <linusg@serenityos.org>
* Copyright (c) 2021, Luke Wilde <lukew@serenityos.org>
* Copyright (c) 2021, Sam Atkins <atkinssj@serenityos.org>
*
* SPDX-License-Identifier: BSD-2-Clause
*/
#include <AK/CharacterTypes.h>
#include <AK/StringBuilder.h>
#include <AK/Utf8View.h>
#include <LibCore/Timer.h>
#include <LibJS/Interpreter.h>
#include <LibJS/Parser.h>
#include <LibJS/Runtime/FunctionObject.h>
#include <LibWeb/Bindings/MainThreadVM.h>
#include <LibWeb/Bindings/WindowObject.h>
#include <LibWeb/CSS/MediaQueryListEvent.h>
#include <LibWeb/CSS/StyleComputer.h>
#include <LibWeb/Cookie/ParsedCookie.h>
#include <LibWeb/DOM/Comment.h>
#include <LibWeb/DOM/CustomEvent.h>
#include <LibWeb/DOM/DOMException.h>
#include <LibWeb/DOM/DOMImplementation.h>
#include <LibWeb/DOM/Document.h>
#include <LibWeb/DOM/DocumentFragment.h>
#include <LibWeb/DOM/DocumentType.h>
#include <LibWeb/DOM/Element.h>
#include <LibWeb/DOM/ElementFactory.h>
#include <LibWeb/DOM/Event.h>
#include <LibWeb/DOM/ExceptionOr.h>
#include <LibWeb/DOM/HTMLCollection.h>
#include <LibWeb/DOM/Range.h>
#include <LibWeb/DOM/ShadowRoot.h>
#include <LibWeb/DOM/Text.h>
#include <LibWeb/DOM/Window.h>
#include <LibWeb/Dump.h>
#include <LibWeb/HTML/AttributeNames.h>
#include <LibWeb/HTML/BrowsingContext.h>
#include <LibWeb/HTML/EventLoop/EventLoop.h>
#include <LibWeb/HTML/EventNames.h>
#include <LibWeb/HTML/HTMLAnchorElement.h>
#include <LibWeb/HTML/HTMLAreaElement.h>
#include <LibWeb/HTML/HTMLBodyElement.h>
#include <LibWeb/HTML/HTMLEmbedElement.h>
#include <LibWeb/HTML/HTMLFormElement.h>
#include <LibWeb/HTML/HTMLFrameSetElement.h>
#include <LibWeb/HTML/HTMLHeadElement.h>
#include <LibWeb/HTML/HTMLHtmlElement.h>
#include <LibWeb/HTML/HTMLIFrameElement.h>
#include <LibWeb/HTML/HTMLImageElement.h>
#include <LibWeb/HTML/HTMLScriptElement.h>
#include <LibWeb/HTML/HTMLTitleElement.h>
#include <LibWeb/HTML/MessageEvent.h>
#include <LibWeb/Layout/BlockFormattingContext.h>
#include <LibWeb/Layout/InitialContainingBlock.h>
#include <LibWeb/Layout/TreeBuilder.h>
#include <LibWeb/Namespace.h>
#include <LibWeb/Origin.h>
#include <LibWeb/Page/Page.h>
#include <LibWeb/SVG/TagNames.h>
#include <LibWeb/UIEvents/EventNames.h>
#include <LibWeb/UIEvents/KeyboardEvent.h>
#include <LibWeb/UIEvents/MouseEvent.h>
namespace Web::DOM {
Document::Document(const AK::URL& url)
: ParentNode(*this, NodeType::DOCUMENT_NODE)
, m_style_computer(make<CSS::StyleComputer>(*this))
, m_style_sheets(CSS::StyleSheetList::create(*this))
, m_url(url)
, m_window(Window::create_with_document(*this))
, m_implementation(DOMImplementation::create({}, *this))
, m_history(HTML::History::create(*this))
{
HTML::main_thread_event_loop().register_document({}, *this);
m_style_update_timer = Core::Timer::create_single_shot(0, [this] {
update_style();
});
m_layout_update_timer = Core::Timer::create_single_shot(0, [this] {
force_layout();
});
}
Document::~Document()
{
}
void Document::removed_last_ref()
{
VERIFY(!ref_count());
VERIFY(!m_deletion_has_begun);
if (m_referencing_node_count) {
// The document has reached ref_count==0 but still has nodes keeping it alive.
// At this point, sever all the node links we control.
// If nodes remain elsewhere (e.g JS wrappers), they will keep the document alive.
// NOTE: This makes sure we stay alive across for the duration of the cleanup below.
increment_referencing_node_count();
m_focused_element = nullptr;
m_hovered_node = nullptr;
m_pending_parsing_blocking_script = nullptr;
m_inspected_node = nullptr;
m_scripts_to_execute_when_parsing_has_finished.clear();
m_scripts_to_execute_as_soon_as_possible.clear();
m_associated_inert_template_document = nullptr;
m_interpreter = nullptr;
{
// Gather up all the descendants of this document and prune them from the tree.
// FIXME: This could definitely be more elegant.
NonnullRefPtrVector<Node> descendants;
for_each_in_inclusive_subtree([&](auto& node) {
if (&node != this)
descendants.append(node);
return IterationDecision::Continue;
});
for (auto& node : descendants) {
VERIFY(&node.document() == this);
VERIFY(!node.is_document());
if (node.parent())
node.remove();
}
}
m_in_removed_last_ref = false;
decrement_referencing_node_count();
return;
}
m_in_removed_last_ref = false;
m_deletion_has_begun = true;
HTML::main_thread_event_loop().unregister_document({}, *this);
delete this;
}
Origin Document::origin() const
{
if (!m_url.is_valid())
return {};
return { m_url.protocol(), m_url.host(), m_url.port_or_default() };
}
void Document::set_origin(const Origin& origin)
{
m_url.set_protocol(origin.protocol());
m_url.set_host(origin.host());
m_url.set_port(origin.port());
}
void Document::schedule_style_update()
{
if (m_style_update_timer->is_active())
return;
m_style_update_timer->start();
}
void Document::schedule_layout_update()
{
if (m_layout_update_timer->is_active())
return;
m_layout_update_timer->start();
}
bool Document::is_child_allowed(const Node& node) const
{
switch (node.type()) {
case NodeType::DOCUMENT_NODE:
case NodeType::TEXT_NODE:
return false;
case NodeType::COMMENT_NODE:
return true;
case NodeType::DOCUMENT_TYPE_NODE:
return !first_child_of_type<DocumentType>();
case NodeType::ELEMENT_NODE:
return !first_child_of_type<Element>();
default:
return false;
}
}
Element* Document::document_element()
{
return first_child_of_type<Element>();
}
const Element* Document::document_element() const
{
return first_child_of_type<Element>();
}
HTML::HTMLHtmlElement* Document::html_element()
{
auto* html = document_element();
if (is<HTML::HTMLHtmlElement>(html))
return verify_cast<HTML::HTMLHtmlElement>(html);
return nullptr;
}
HTML::HTMLHeadElement* Document::head()
{
auto* html = html_element();
if (!html)
return nullptr;
return html->first_child_of_type<HTML::HTMLHeadElement>();
}
HTML::HTMLElement* Document::body()
{
auto* html = html_element();
if (!html)
return nullptr;
auto* first_body = html->first_child_of_type<HTML::HTMLBodyElement>();
if (first_body)
return first_body;
auto* first_frameset = html->first_child_of_type<HTML::HTMLFrameSetElement>();
if (first_frameset)
return first_frameset;
return nullptr;
}
// https://html.spec.whatwg.org/multipage/dom.html#dom-document-body
ExceptionOr<void> Document::set_body(HTML::HTMLElement* new_body)
{
if (!is<HTML::HTMLBodyElement>(new_body) && !is<HTML::HTMLFrameSetElement>(new_body))
return DOM::HierarchyRequestError::create("Invalid document body element, must be 'body' or 'frameset'");
auto* existing_body = body();
if (existing_body) {
auto replace_result = existing_body->parent()->replace_child(*new_body, *existing_body);
if (replace_result.is_exception())
return replace_result.exception();
return {};
}
auto* document_element = this->document_element();
if (!document_element)
return DOM::HierarchyRequestError::create("Missing document element");
auto append_result = document_element->append_child(*new_body);
if (append_result.is_exception())
return append_result.exception();
return {};
}
String Document::title() const
{
auto* head_element = head();
if (!head_element)
return {};
auto* title_element = head_element->first_child_of_type<HTML::HTMLTitleElement>();
if (!title_element)
return {};
auto raw_title = title_element->text_content();
StringBuilder builder;
bool last_was_space = false;
for (auto code_point : Utf8View(raw_title)) {
if (is_ascii_space(code_point)) {
last_was_space = true;
} else {
if (last_was_space && !builder.is_empty())
builder.append(' ');
builder.append_code_point(code_point);
last_was_space = false;
}
}
return builder.to_string();
}
void Document::set_title(const String& title)
{
auto* head_element = const_cast<HTML::HTMLHeadElement*>(head());
if (!head_element)
return;
RefPtr<HTML::HTMLTitleElement> title_element = head_element->first_child_of_type<HTML::HTMLTitleElement>();
if (!title_element) {
title_element = static_ptr_cast<HTML::HTMLTitleElement>(create_element(HTML::TagNames::title));
head_element->append_child(*title_element);
}
title_element->remove_all_children(true);
title_element->append_child(adopt_ref(*new Text(*this, title)));
if (auto* page = this->page()) {
if (browsing_context() == &page->top_level_browsing_context())
page->client().page_did_change_title(title);
}
}
void Document::attach_to_browsing_context(Badge<HTML::BrowsingContext>, HTML::BrowsingContext& browsing_context)
{
m_browsing_context = browsing_context;
update_layout();
}
void Document::detach_from_browsing_context(Badge<HTML::BrowsingContext>, HTML::BrowsingContext& browsing_context)
{
VERIFY(&browsing_context == m_browsing_context);
tear_down_layout_tree();
m_browsing_context = nullptr;
}
void Document::tear_down_layout_tree()
{
if (!m_layout_root)
return;
// Gather up all the layout nodes in a vector and detach them from parents
// while the vector keeps them alive.
NonnullRefPtrVector<Layout::Node> layout_nodes;
m_layout_root->for_each_in_inclusive_subtree([&](auto& layout_node) {
layout_nodes.append(layout_node);
return IterationDecision::Continue;
});
for (auto& layout_node : layout_nodes) {
if (layout_node.parent())
layout_node.parent()->remove_child(layout_node);
}
m_layout_root = nullptr;
}
Color Document::background_color(const Palette& palette) const
{
auto default_color = palette.base();
auto* body_element = body();
if (!body_element)
return default_color;
auto* body_layout_node = body_element->layout_node();
if (!body_layout_node)
return default_color;
auto color = body_layout_node->computed_values().background_color();
if (!color.alpha())
return default_color;
return color;
}
Vector<CSS::BackgroundLayerData> const* Document::background_layers() const
{
auto* body_element = body();
if (!body_element)
return {};
auto* body_layout_node = body_element->layout_node();
if (!body_layout_node)
return {};
return &body_layout_node->background_layers();
}
// https://html.spec.whatwg.org/multipage/urls-and-fetching.html#parse-a-url
AK::URL Document::parse_url(String const& url) const
{
// FIXME: Make sure we do this according to spec.
return m_url.complete_url(url);
}
void Document::set_needs_layout()
{
if (m_needs_layout)
return;
m_needs_layout = true;
schedule_layout_update();
}
void Document::force_layout()
{
tear_down_layout_tree();
update_layout();
}
void Document::ensure_layout()
{
if (m_needs_layout || !m_layout_root)
update_layout();
}
void Document::update_layout()
{
if (!m_needs_layout && m_layout_root)
return;
if (!browsing_context())
return;
update_style();
if (!m_layout_root) {
Layout::TreeBuilder tree_builder;
m_layout_root = static_ptr_cast<Layout::InitialContainingBlock>(tree_builder.build(*this));
}
Layout::BlockFormattingContext root_formatting_context(*m_layout_root, nullptr);
root_formatting_context.run(*m_layout_root, Layout::LayoutMode::Default);
m_layout_root->set_needs_display();
if (browsing_context()->is_top_level()) {
if (auto* page = this->page())
page->client().page_did_layout();
}
m_needs_layout = false;
m_layout_update_timer->stop();
}
static void update_style_recursively(DOM::Node& node)
{
if (is<Element>(node))
static_cast<Element&>(node).recompute_style();
node.set_needs_style_update(false);
if (node.child_needs_style_update()) {
node.for_each_child([&](auto& child) {
if (child.needs_style_update() || child.child_needs_style_update())
update_style_recursively(child);
return IterationDecision::Continue;
});
}
node.set_child_needs_style_update(false);
}
void Document::update_style()
{
if (!browsing_context())
return;
if (!needs_style_update() && !child_needs_style_update())
return;
update_style_recursively(*this);
m_style_update_timer->stop();
set_needs_layout();
}
RefPtr<Layout::Node> Document::create_layout_node()
{
return adopt_ref(*new Layout::InitialContainingBlock(*this, style_computer().create_document_style()));
}
void Document::set_link_color(Color color)
{
m_link_color = color;
}
void Document::set_active_link_color(Color color)
{
m_active_link_color = color;
}
void Document::set_visited_link_color(Color color)
{
m_visited_link_color = color;
}
const Layout::InitialContainingBlock* Document::layout_node() const
{
return static_cast<const Layout::InitialContainingBlock*>(Node::layout_node());
}
Layout::InitialContainingBlock* Document::layout_node()
{
return static_cast<Layout::InitialContainingBlock*>(Node::layout_node());
}
void Document::set_inspected_node(Node* node)
{
if (m_inspected_node == node)
return;
if (m_inspected_node && m_inspected_node->layout_node())
m_inspected_node->layout_node()->set_needs_display();
m_inspected_node = node;
if (m_inspected_node && m_inspected_node->layout_node())
m_inspected_node->layout_node()->set_needs_display();
}
void Document::set_hovered_node(Node* node)
{
if (m_hovered_node == node)
return;
RefPtr<Node> old_hovered_node = move(m_hovered_node);
m_hovered_node = node;
invalidate_style();
}
NonnullRefPtr<HTMLCollection> Document::get_elements_by_name(String const& name)
{
return HTMLCollection::create(*this, [name](Element const& element) {
return element.name() == name;
});
}
NonnullRefPtr<HTMLCollection> Document::get_elements_by_class_name(FlyString const& class_name)
{
return HTMLCollection::create(*this, [class_name, quirks_mode = document().in_quirks_mode()](Element const& element) {
return element.has_class(class_name, quirks_mode ? CaseSensitivity::CaseInsensitive : CaseSensitivity::CaseSensitive);
});
}
// https://html.spec.whatwg.org/multipage/obsolete.html#dom-document-applets
NonnullRefPtr<HTMLCollection> Document::applets()
{
// FIXME: This should return the same HTMLCollection object every time,
// but that would cause a reference cycle since HTMLCollection refs the root.
return HTMLCollection::create(*this, [](auto&) { return false; });
}
// https://html.spec.whatwg.org/multipage/obsolete.html#dom-document-anchors
NonnullRefPtr<HTMLCollection> Document::anchors()
{
// FIXME: This should return the same HTMLCollection object every time,
// but that would cause a reference cycle since HTMLCollection refs the root.
return HTMLCollection::create(*this, [](Element const& element) {
return is<HTML::HTMLAnchorElement>(element) && element.has_attribute(HTML::AttributeNames::name);
});
}
// https://html.spec.whatwg.org/multipage/dom.html#dom-document-images
NonnullRefPtr<HTMLCollection> Document::images()
{
// FIXME: This should return the same HTMLCollection object every time,
// but that would cause a reference cycle since HTMLCollection refs the root.
return HTMLCollection::create(*this, [](Element const& element) {
return is<HTML::HTMLImageElement>(element);
});
}
// https://html.spec.whatwg.org/multipage/dom.html#dom-document-embeds
NonnullRefPtr<HTMLCollection> Document::embeds()
{
// FIXME: This should return the same HTMLCollection object every time,
// but that would cause a reference cycle since HTMLCollection refs the root.
return HTMLCollection::create(*this, [](Element const& element) {
return is<HTML::HTMLEmbedElement>(element);
});
}
// https://html.spec.whatwg.org/multipage/dom.html#dom-document-plugins
NonnullRefPtr<HTMLCollection> Document::plugins()
{
return embeds();
}
// https://html.spec.whatwg.org/multipage/dom.html#dom-document-links
NonnullRefPtr<HTMLCollection> Document::links()
{
// FIXME: This should return the same HTMLCollection object every time,
// but that would cause a reference cycle since HTMLCollection refs the root.
return HTMLCollection::create(*this, [](Element const& element) {
return (is<HTML::HTMLAnchorElement>(element) || is<HTML::HTMLAreaElement>(element)) && element.has_attribute(HTML::AttributeNames::href);
});
}
// https://html.spec.whatwg.org/multipage/dom.html#dom-document-forms
NonnullRefPtr<HTMLCollection> Document::forms()
{
// FIXME: This should return the same HTMLCollection object every time,
// but that would cause a reference cycle since HTMLCollection refs the root.
return HTMLCollection::create(*this, [](Element const& element) {
return is<HTML::HTMLFormElement>(element);
});
}
// https://html.spec.whatwg.org/multipage/dom.html#dom-document-scripts
NonnullRefPtr<HTMLCollection> Document::scripts()
{
// FIXME: This should return the same HTMLCollection object every time,
// but that would cause a reference cycle since HTMLCollection refs the root.
return HTMLCollection::create(*this, [](Element const& element) {
return is<HTML::HTMLScriptElement>(element);
});
}
Color Document::link_color() const
{
if (m_link_color.has_value())
return m_link_color.value();
if (!page())
return Color::Blue;
return page()->palette().link();
}
Color Document::active_link_color() const
{
if (m_active_link_color.has_value())
return m_active_link_color.value();
if (!page())
return Color::Red;
return page()->palette().active_link();
}
Color Document::visited_link_color() const
{
if (m_visited_link_color.has_value())
return m_visited_link_color.value();
if (!page())
return Color::Magenta;
return page()->palette().visited_link();
}
JS::Realm& Document::realm()
{
return interpreter().realm();
}
JS::Interpreter& Document::interpreter()
{
if (!m_interpreter) {
auto& vm = Bindings::main_thread_vm();
m_interpreter = JS::Interpreter::create<Bindings::WindowObject>(vm, *m_window);
// NOTE: We must hook `on_call_stack_emptied` after the interpreter was created, as the initialization of the
// WindowsObject can invoke some internal calls, which will eventually lead to this hook being called without
// `m_interpreter` being fully initialized yet.
// TODO: Hook up vm.on_promise_unhandled_rejection and vm.on_promise_rejection_handled
// See https://developer.mozilla.org/en-US/docs/Web/JavaScript/Guide/Using_promises#promise_rejection_events
vm.on_call_stack_emptied = [this] {
auto& vm = m_interpreter->vm();
vm.run_queued_promise_jobs();
vm.run_queued_finalization_registry_cleanup_jobs();
// FIXME: This isn't exactly the right place for this.
HTML::main_thread_event_loop().perform_a_microtask_checkpoint();
// Note: This is not an exception check for the promise jobs, they will just leave any
// exception that already exists intact and never throw a new one (without cleaning it
// up, that is). Taking care of any previous unhandled exception just happens to be the
// very last thing we want to do, even after running promise jobs.
if (auto* exception = vm.exception()) {
auto value = exception->value();
if (value.is_object()) {
auto& object = value.as_object();
auto name = object.get_without_side_effects(vm.names.name).value_or(JS::js_undefined());
auto message = object.get_without_side_effects(vm.names.message).value_or(JS::js_undefined());
if (name.is_accessor() || message.is_accessor()) {
// The result is not going to be useful, let's just print the value. This affects DOMExceptions, for example.
dbgln("\033[31;1mUnhandled JavaScript exception:\033[0m {}", value);
} else {
dbgln("\033[31;1mUnhandled JavaScript exception:\033[0m [{}] {}", name, message);
}
} else {
dbgln("\033[31;1mUnhandled JavaScript exception:\033[0m {}", value);
}
for (auto& traceback_frame : exception->traceback()) {
auto& function_name = traceback_frame.function_name;
auto& source_range = traceback_frame.source_range;
dbgln(" {} at {}:{}:{}", function_name, source_range.filename, source_range.start.line, source_range.start.column);
}
}
vm.finish_execution_generation();
};
}
return *m_interpreter;
}
JS::Value Document::run_javascript(StringView source, StringView filename)
{
// FIXME: The only user of this function now is javascript: URLs. Refactor them to follow the spec: https://html.spec.whatwg.org/multipage/browsing-the-web.html#javascript-protocol
auto& interpreter = document().interpreter();
auto script_or_error = JS::Script::parse(source, interpreter.realm(), filename);
if (script_or_error.is_error()) {
// FIXME: Add error logging back.
return JS::js_undefined();
}
auto result = interpreter.run(script_or_error.value());
auto& vm = interpreter.vm();
if (result.is_error()) {
// FIXME: I'm sure the spec could tell us something about error propagation here!
vm.clear_exception();
return {};
}
return result.value();
}
// https://dom.spec.whatwg.org/#dom-document-createelement
// FIXME: This only implements step 6 of the algorithm and does not take in options.
NonnullRefPtr<Element> Document::create_element(const String& tag_name)
{
// FIXME: Let namespace be the HTML namespace, if this is an HTML document or thiss content type is "application/xhtml+xml", and null otherwise.
return DOM::create_element(*this, tag_name, Namespace::HTML);
}
// https://dom.spec.whatwg.org/#internal-createelementns-steps
// FIXME: This only implements step 4 of the algorithm and does not take in options.
NonnullRefPtr<Element> Document::create_element_ns(const String& namespace_, const String& qualified_name)
{
return DOM::create_element(*this, qualified_name, namespace_);
}
NonnullRefPtr<DocumentFragment> Document::create_document_fragment()
{
return adopt_ref(*new DocumentFragment(*this));
}
NonnullRefPtr<Text> Document::create_text_node(const String& data)
{
return adopt_ref(*new Text(*this, data));
}
NonnullRefPtr<Comment> Document::create_comment(const String& data)
{
return adopt_ref(*new Comment(*this, data));
}
NonnullRefPtr<Range> Document::create_range()
{
return Range::create(*this);
}
// https://dom.spec.whatwg.org/#dom-document-createevent
NonnullRefPtr<Event> Document::create_event(const String& interface)
{
auto interface_lowercase = interface.to_lowercase();
RefPtr<Event> event;
if (interface_lowercase == "beforeunloadevent") {
event = Event::create(""); // FIXME: Create BeforeUnloadEvent
} else if (interface_lowercase == "compositionevent") {
event = Event::create(""); // FIXME: Create CompositionEvent
} else if (interface_lowercase == "customevent") {
event = CustomEvent::create("");
} else if (interface_lowercase == "devicemotionevent") {
event = Event::create(""); // FIXME: Create DeviceMotionEvent
} else if (interface_lowercase == "deviceorientationevent") {
event = Event::create(""); // FIXME: Create DeviceOrientationEvent
} else if (interface_lowercase == "dragevent") {
event = Event::create(""); // FIXME: Create DragEvent
} else if (interface_lowercase.is_one_of("event", "events")) {
event = Event::create("");
} else if (interface_lowercase == "focusevent") {
event = Event::create(""); // FIXME: Create FocusEvent
} else if (interface_lowercase == "hashchangeevent") {
event = Event::create(""); // FIXME: Create HashChangeEvent
} else if (interface_lowercase == "htmlevents") {
event = Event::create("");
} else if (interface_lowercase == "keyboardevent") {
event = UIEvents::KeyboardEvent::create("");
} else if (interface_lowercase == "messageevent") {
event = HTML::MessageEvent::create("");
} else if (interface_lowercase.is_one_of("mouseevent", "mouseevents")) {
event = UIEvents::MouseEvent::create("", 0, 0, 0, 0);
} else if (interface_lowercase == "storageevent") {
event = Event::create(""); // FIXME: Create StorageEvent
} else if (interface_lowercase == "svgevents") {
event = Event::create("");
} else if (interface_lowercase == "textevent") {
event = Event::create(""); // FIXME: Create CompositionEvent
} else if (interface_lowercase == "touchevent") {
event = Event::create(""); // FIXME: Create TouchEvent
} else if (interface_lowercase.is_one_of("uievent", "uievents")) {
event = UIEvents::UIEvent::create("");
} else {
// FIXME:
// 3. If constructor is null, then throw a "NotSupportedError" DOMException.
// 4. If the interface indicated by constructor is not exposed on the relevant global object of this, then throw a "NotSupportedError" DOMException.
TODO();
}
// Setting type to empty string is handled by each constructor.
// FIXME:
// 7. Initialize events timeStamp attribute to a DOMHighResTimeStamp representing the high resolution time from the time origin to now.
event->set_is_trusted(false);
event->set_initialized(false);
return event.release_nonnull();
}
void Document::set_pending_parsing_blocking_script(Badge<HTML::HTMLScriptElement>, HTML::HTMLScriptElement* script)
{
m_pending_parsing_blocking_script = script;
}
NonnullRefPtr<HTML::HTMLScriptElement> Document::take_pending_parsing_blocking_script(Badge<HTML::HTMLParser>)
{
return m_pending_parsing_blocking_script.release_nonnull();
}
void Document::add_script_to_execute_when_parsing_has_finished(Badge<HTML::HTMLScriptElement>, HTML::HTMLScriptElement& script)
{
m_scripts_to_execute_when_parsing_has_finished.append(script);
}
NonnullRefPtrVector<HTML::HTMLScriptElement> Document::take_scripts_to_execute_when_parsing_has_finished(Badge<HTML::HTMLParser>)
{
return move(m_scripts_to_execute_when_parsing_has_finished);
}
void Document::add_script_to_execute_as_soon_as_possible(Badge<HTML::HTMLScriptElement>, HTML::HTMLScriptElement& script)
{
m_scripts_to_execute_as_soon_as_possible.append(script);
}
NonnullRefPtrVector<HTML::HTMLScriptElement> Document::take_scripts_to_execute_as_soon_as_possible(Badge<HTML::HTMLParser>)
{
return move(m_scripts_to_execute_as_soon_as_possible);
}
// https://dom.spec.whatwg.org/#dom-document-importnode
ExceptionOr<NonnullRefPtr<Node>> Document::import_node(NonnullRefPtr<Node> node, bool deep)
{
// 1. If node is a document or shadow root, then throw a "NotSupportedError" DOMException.
if (is<Document>(*node) || is<ShadowRoot>(*node))
return DOM::NotSupportedError::create("Cannot import a document or shadow root.");
// 2. Return a clone of node, with this and the clone children flag set if deep is true.
return node->clone_node(this, deep);
}
// https://dom.spec.whatwg.org/#concept-node-adopt
void Document::adopt_node(Node& node)
{
auto& old_document = node.document();
if (node.parent())
node.remove();
if (&old_document != this) {
// FIXME: This should be shadow-including.
node.for_each_in_inclusive_subtree([&](auto& inclusive_descendant) {
inclusive_descendant.set_document({}, *this);
// FIXME: If inclusiveDescendant is an element, then set the node document of each attribute in inclusiveDescendants attribute list to document.
return IterationDecision::Continue;
});
// FIXME: For each inclusiveDescendant in nodes shadow-including inclusive descendants that is custom,
// enqueue a custom element callback reaction with inclusiveDescendant, callback name "adoptedCallback",
// and an argument list containing oldDocument and document.
// FIXME: This should be shadow-including.
node.for_each_in_inclusive_subtree([&](auto& inclusive_descendant) {
inclusive_descendant.adopted_from(old_document);
return IterationDecision::Continue;
});
}
}
// https://dom.spec.whatwg.org/#dom-document-adoptnode
ExceptionOr<NonnullRefPtr<Node>> Document::adopt_node_binding(NonnullRefPtr<Node> node)
{
if (is<Document>(*node))
return DOM::NotSupportedError::create("Cannot adopt a document into a document");
if (is<ShadowRoot>(*node))
return DOM::HierarchyRequestError::create("Cannot adopt a shadow root into a document");
if (is<DocumentFragment>(*node) && verify_cast<DocumentFragment>(*node).host())
return node;
adopt_node(*node);
return node;
}
const DocumentType* Document::doctype() const
{
return first_child_of_type<DocumentType>();
}
const String& Document::compat_mode() const
{
static String back_compat = "BackCompat";
static String css1_compat = "CSS1Compat";
if (m_quirks_mode == QuirksMode::Yes)
return back_compat;
return css1_compat;
}
bool Document::is_editable() const
{
return m_editable;
}
void Document::set_focused_element(Element* element)
{
if (m_focused_element == element)
return;
m_focused_element = element;
if (m_layout_root)
m_layout_root->set_needs_display();
}
void Document::set_active_element(Element* element)
{
if (m_active_element == element)
return;
m_active_element = element;
if (m_layout_root)
m_layout_root->set_needs_display();
}
String Document::ready_state() const
{
switch (m_readiness) {
case HTML::DocumentReadyState::Loading:
return "loading"sv;
case HTML::DocumentReadyState::Interactive:
return "interactive"sv;
case HTML::DocumentReadyState::Complete:
return "complete"sv;
}
VERIFY_NOT_REACHED();
}
// https://html.spec.whatwg.org/#update-the-current-document-readiness
void Document::update_readiness(HTML::DocumentReadyState readiness_value)
{
// 1. If document's current document readiness equals readinessValue, then return.
if (m_readiness == readiness_value)
return;
// The spec doesn't actually mention updating the current readiness value.
// FIXME: https://github.com/whatwg/html/issues/7120
m_readiness = readiness_value;
// FIXME: 2. If document is associated with an HTML parser, then:
// FIXME: 1. If document is associated with an HTML parser, then:
// FIXME: 2. If readinessValue is "complete", and document's load timing info's DOM complete time is 0, then set document's load timing info's DOM complete time to now.
// FIXME: 3. Otherwise, if readinessValue is "interactive", and document's load timing info's DOM interactive time is 0, then set document's load timing info's DOM interactive time to now.
// 3. Fire an event named readystatechange at document.
dispatch_event(Event::create(HTML::EventNames::readystatechange));
}
Page* Document::page()
{
return m_browsing_context ? m_browsing_context->page() : nullptr;
}
const Page* Document::page() const
{
return m_browsing_context ? m_browsing_context->page() : nullptr;
}
EventTarget* Document::get_parent(const Event& event)
{
if (event.type() == HTML::EventNames::load)
return nullptr;
return &window();
}
// https://html.spec.whatwg.org/multipage/browsing-the-web.html#completely-finish-loading
void Document::completely_finish_loading()
{
// 1. Assert: document's browsing context is non-null.
VERIFY(browsing_context());
// FIXME: 2. Set document's completely loaded time to the current time.
// 3. Let container be document's browsing context's container.
auto* container = browsing_context()->container();
// If container is an iframe element, then queue an element task on the DOM manipulation task source given container to run the iframe load event steps given container.
if (container && is<HTML::HTMLIFrameElement>(*container)) {
container->queue_an_element_task(HTML::Task::Source::DOMManipulation, [container]() mutable {
run_iframe_load_event_steps(static_cast<HTML::HTMLIFrameElement&>(*container));
});
}
// Otherwise, if container is non-null, then queue an element task on the DOM manipulation task source given container to fire an event named load at container.
else if (container) {
container->queue_an_element_task(HTML::Task::Source::DOMManipulation, [container]() mutable {
container->dispatch_event(DOM::Event::create(HTML::EventNames::load));
});
}
}
String Document::cookie(Cookie::Source source)
{
if (auto* page = this->page())
return page->client().page_did_request_cookie(m_url, source);
return {};
}
void Document::set_cookie(String cookie_string, Cookie::Source source)
{
auto cookie = Cookie::parse_cookie(cookie_string);
if (!cookie.has_value())
return;
if (auto* page = this->page())
page->client().page_did_set_cookie(m_url, cookie.value(), source);
}
String Document::dump_dom_tree_as_json() const
{
StringBuilder builder;
JsonObjectSerializer json(builder);
serialize_tree_as_json(json);
json.finish();
return builder.to_string();
}
// https://html.spec.whatwg.org/multipage/semantics.html#has-a-style-sheet-that-is-blocking-scripts
bool Document::has_a_style_sheet_that_is_blocking_scripts() const
{
// A Document has a style sheet that is blocking scripts if its script-blocking style sheet counter is greater than 0,
if (m_script_blocking_style_sheet_counter > 0)
return true;
// ...or if that Document has a non-null browsing context whose container document is non-null and has a script-blocking style sheet counter greater than 0.
if (!browsing_context() || !browsing_context()->container_document())
return false;
return browsing_context()->container_document()->m_script_blocking_style_sheet_counter > 0;
}
String Document::referrer() const
{
// FIXME: Return the document's actual referrer.
return "";
}
// https://html.spec.whatwg.org/multipage/browsers.html#fully-active
bool Document::is_fully_active() const
{
// A Document d is said to be fully active when d's browsing context is non-null, d's browsing context's active document is d,
// and either d's browsing context is a top-level browsing context, or d's browsing context's container document is fully active.
return browsing_context() && browsing_context()->active_document() == this && (browsing_context()->is_top_level() || browsing_context()->container_document()->is_fully_active());
}
// https://html.spec.whatwg.org/multipage/browsers.html#active-document
bool Document::is_active() const
{
// A browsing context's active document is its active window's associated Document.
return browsing_context() && browsing_context()->active_document() == this;
}
// https://html.spec.whatwg.org/multipage/history.html#dom-document-location
Bindings::LocationObject* Document::location()
{
// The Document object's location attribute's getter must return this Document object's relevant global object's Location object,
// if this Document object is fully active, and null otherwise.
if (!is_fully_active())
return nullptr;
return window().wrapper()->location_object();
}
// https://html.spec.whatwg.org/multipage/interaction.html#dom-document-hidden
bool Document::hidden() const
{
return false;
}
// https://html.spec.whatwg.org/multipage/interaction.html#dom-document-visibilitystate
String Document::visibility_state() const
{
return hidden() ? "hidden" : "visible";
}
// https://drafts.csswg.org/cssom-view/#run-the-resize-steps
void Document::run_the_resize_steps()
{
// 1. If docs viewport has had its width or height changed
// (e.g. as a result of the user resizing the browser window, or changing the page zoom scale factor,
// or an iframe elements dimensions are changed) since the last time these steps were run,
// fire an event named resize at the Window object associated with doc.
if (!browsing_context())
return;
auto viewport_size = browsing_context()->viewport_rect().size();
if (m_last_viewport_size == viewport_size)
return;
m_last_viewport_size = viewport_size;
dispatch_event(DOM::Event::create(UIEvents::EventNames::resize));
update_layout();
}
void Document::add_media_query_list(NonnullRefPtr<CSS::MediaQueryList>& media_query_list)
{
m_media_query_lists.append(media_query_list);
}
// https://drafts.csswg.org/cssom-view/#evaluate-media-queries-and-report-changes
void Document::evaluate_media_queries_and_report_changes()
{
// NOTE: Not in the spec, but we take this opportunity to prune null WeakPtrs.
m_media_query_lists.remove_all_matching([](auto& it) {
return it.is_null();
});
// 1. For each MediaQueryList object target that has doc as its document,
// in the order they were created, oldest first, run these substeps:
for (auto& media_query_list_ptr : m_media_query_lists) {
// 1.1. If targets matches state has changed since the last time these steps
// were run, fire an event at target using the MediaQueryListEvent constructor,
// with its type attribute initialized to change, its isTrusted attribute
// initialized to true, its media attribute initialized to targets media,
// and its matches attribute initialized to targets matches state.
if (media_query_list_ptr.is_null())
continue;
auto media_query_list = media_query_list_ptr.strong_ref();
bool did_match = media_query_list->matches();
bool now_matches = media_query_list->evaluate();
if (did_match != now_matches) {
CSS::MediaQueryListEventInit init;
init.media = media_query_list->media();
init.matches = now_matches;
auto event = CSS::MediaQueryListEvent::create(HTML::EventNames::change, init);
event->set_is_trusted(true);
media_query_list->dispatch_event(event);
}
}
// Also not in the spec, but this is as good a place as any to evaluate @media rules!
for (auto& style_sheet : style_sheets().sheets()) {
style_sheet.evaluate_media_queries(window());
}
}
NonnullRefPtr<DOMImplementation> Document::implementation() const
{
return *m_implementation;
}
}